C14H20O4 — CID 66222745
7-(2,2-dimethoxyethoxy)-2,2-dimethyl-3H-1-benzofuran (PubChem CID 66222745) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 7-(2,2-dimethoxyethoxy)-2,2-dimethyl-3H-1-benzofuran.
| Compound Name | 7-(2,2-dimethoxyethoxy)-2,2-dimethyl-3H-1-benzofuran |
|---|---|
| PubChem CID | 66222745 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 7-(2,2-dimethoxyethoxy)-2,2-dimethyl-3H-1-benzofuran |
| SMILES | COC(COc1cccc2c1OC(C)(C)C2)OC |
| InChI | InChI=1S/C14H20O4/c1-14(2)8-10-6-5-7-11(13(10)18-14)17-9-12(15-3)16-4/h5-7,12H,8-9H2,1-4H3 |
| InChIKey | DQSREOCPOMBYOD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|