About (2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol
(2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol (PubChem CID 124588927) has the molecular formula C18H26O5
and a molecular weight of 322.40 g/mol. Its IUPAC name is (2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol |
| PubChem CID | 124588927 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | (2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol |
| SMILES | CC1(C)Cc2cccc(OC[C@H](O)COC3CCOCC3)c2O1 |
| InChI | InChI=1S/C18H26O5/c1-18(2)10-13-4-3-5-16(17(13)23-18)22-12-14(19)11-21-15-6-8-20-9-7-15/h3-5,14-15,19H,6-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | HAGAZOJTPDGVDF-CQSZACIVSA-N |
| XLogP | 2.34 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol?
The IUPAC name of (2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol (CID 124588927) is (2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol.
What is the SMILES notation for (2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol?
The canonical SMILES for (2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol is CC1(C)Cc2cccc(OC[C@H](O)COC3CCOCC3)c2O1.
What is the InChIKey of (2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol?
The InChIKey is HAGAZOJTPDGVDF-CQSZACIVSA-N. The full InChI is InChI=1S/C18H26O5/c1-18(2)10-13-4-3-5-16(17(13)23-18)22-12-14(19)11-21-15-6-8-20-9-7-15/h3-5,14-15,19H,6-12H2,1-2H3/t14-/m1/s1.
What are the key properties of (2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol?
(2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol has a molecular weight of 322.40 g/mol, XLogP of 2.34, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-3-(oxan-4-yloxy)propan-2-ol is sourced from PubChem (CID 124588927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).