C21H35NO4S — CID 16884108
N,N-dibutyl-3-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propane-1-sulfonamide (PubChem CID 16884108) has the molecular formula C21H35NO4S and a molecular weight of 397.58 g/mol. Its IUPAC name is N,N-dibutyl-3-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propane-1-sulfonamide.
| Compound Name | N,N-dibutyl-3-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propane-1-sulfonamide |
|---|---|
| PubChem CID | 16884108 |
| Molecular Formula | C21H35NO4S |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N,N-dibutyl-3-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propane-1-sulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)CCCOc1cccc2c1OC(C)(C)C2 |
| InChI | InChI=1S/C21H35NO4S/c1-5-7-13-22(14-8-6-2)27(23,24)16-10-15-25-19-12-9-11-18-17-21(3,4)26-20(18)19/h9,11-12H,5-8,10,13-17H2,1-4H3 |
| InChIKey | VNJLHCNISMEBRH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|