C20H31NO4S — CID 16884120
1-[3-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propylsulfonyl]-3,5-dimethylpiperidine (PubChem CID 16884120) has the molecular formula C20H31NO4S and a molecular weight of 381.54 g/mol. Its IUPAC name is 1-[3-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propylsulfonyl]-3,5-dimethylpiperidine.
| Compound Name | 1-[3-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propylsulfonyl]-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 16884120 |
| Molecular Formula | C20H31NO4S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 1-[3-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propylsulfonyl]-3,5-dimethylpiperidine |
| SMILES | CC1CC(C)CN(S(=O)(=O)CCCOc2cccc3c2OC(C)(C)C3)C1 |
| InChI | InChI=1S/C20H31NO4S/c1-15-11-16(2)14-21(13-15)26(22,23)10-6-9-24-18-8-5-7-17-12-20(3,4)25-19(17)18/h5,7-8,15-16H,6,9-14H2,1-4H3 |
| InChIKey | KMEHJBGVELMRIM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|