C23H31N5O5S — CID 42439793
2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylpropyl]acetamide (PubChem CID 42439793) has the molecular formula C23H31N5O5S and a molecular weight of 489.60 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylpropyl]acetamide.
| Compound Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylpropyl]acetamide |
|---|---|
| PubChem CID | 42439793 |
| Molecular Formula | C23H31N5O5S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylpropyl]acetamide |
| SMILES | CC1(C)Cc2cccc(OCC(=O)NCCCS(=O)(=O)N3CCN(c4ncccn4)CC3)c2O1 |
| InChI | InChI=1S/C23H31N5O5S/c1-23(2)16-18-6-3-7-19(21(18)33-23)32-17-20(29)24-10-5-15-34(30,31)28-13-11-27(12-14-28)22-25-8-4-9-26-22/h3-4,6-9H,5,10-17H2,1-2H3,(H,24,29) |
| InChIKey | LPFRGVMVCYDNRM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|