C25H32FN3O5S — CID 42175607
2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylpropyl]acetamide (PubChem CID 42175607) has the molecular formula C25H32FN3O5S and a molecular weight of 505.61 g/mol. Its IUPAC name is 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylpropyl]acetamide.
| Compound Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylpropyl]acetamide |
|---|---|
| PubChem CID | 42175607 |
| Molecular Formula | C25H32FN3O5S |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]sulfonylpropyl]acetamide |
| SMILES | CC1(C)Cc2cccc(OCC(=O)NCCCS(=O)(=O)N3CCN(c4ccccc4F)CC3)c2O1 |
| InChI | InChI=1S/C25H32FN3O5S/c1-25(2)17-19-7-5-10-22(24(19)34-25)33-18-23(30)27-11-6-16-35(31,32)29-14-12-28(13-15-29)21-9-4-3-8-20(21)26/h3-5,7-10H,6,11-18H2,1-2H3,(H,27,30) |
| InChIKey | NPYNTAGFVLWULG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|