C20H22ClNO4 — CID 4918924
N-[2-(2-chlorophenoxy)ethyl]-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetamide (PubChem CID 4918924) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)ethyl]-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetamide.
| Compound Name | N-[2-(2-chlorophenoxy)ethyl]-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetamide |
|---|---|
| PubChem CID | 4918924 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-[2-(2-chlorophenoxy)ethyl]-2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetamide |
| SMILES | CC1(C)Cc2cccc(OCC(=O)NCCOc3ccccc3Cl)c2O1 |
| InChI | InChI=1S/C20H22ClNO4/c1-20(2)12-14-6-5-9-17(19(14)26-20)25-13-18(23)22-10-11-24-16-8-4-3-7-15(16)21/h3-9H,10-13H2,1-2H3,(H,22,23) |
| InChIKey | GAAJHCBTDCBNHH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|