C19H23N3O5S — CID 38234241
1-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-3-(3-sulfamoylphenyl)urea (PubChem CID 38234241) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is 1-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-3-(3-sulfamoylphenyl)urea.
| Compound Name | 1-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-3-(3-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 38234241 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-3-(3-sulfamoylphenyl)urea |
| SMILES | CC1(C)Cc2cccc(OCCNC(=O)Nc3cccc(S(N)(=O)=O)c3)c2O1 |
| InChI | InChI=1S/C19H23N3O5S/c1-19(2)12-13-5-3-8-16(17(13)27-19)26-10-9-21-18(23)22-14-6-4-7-15(11-14)28(20,24)25/h3-8,11H,9-10,12H2,1-2H3,(H2,20,24,25)(H2,21,22,23) |
| InChIKey | PVVJHWOEUWHACB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|