C20H20N2O3 — CID 31825043
3-cyano-N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]benzamide (PubChem CID 31825043) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-cyano-N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]benzamide.
| Compound Name | 3-cyano-N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]benzamide |
|---|---|
| PubChem CID | 31825043 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 3-cyano-N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]benzamide |
| SMILES | CC1(C)Cc2cccc(OCCNC(=O)c3cccc(C#N)c3)c2O1 |
| InChI | InChI=1S/C20H20N2O3/c1-20(2)12-16-7-4-8-17(18(16)25-20)24-10-9-22-19(23)15-6-3-5-14(11-15)13-21/h3-8,11H,9-10,12H2,1-2H3,(H,22,23) |
| InChIKey | OGXFWVHIYMBCIK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|