C20H20N4O5 — CID 55852614
N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 55852614) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 55852614 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2,4-dioxo-1H-pyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CC1(C)Cc2cccc(OCCNC(=O)c3cnc4[nH]c(=O)[nH]c(=O)c4c3)c2O1 |
| InChI | InChI=1S/C20H20N4O5/c1-20(2)9-11-4-3-5-14(15(11)29-20)28-7-6-21-17(25)12-8-13-16(22-10-12)23-19(27)24-18(13)26/h3-5,8,10H,6-7,9H2,1-2H3,(H,21,25)(H2,22,23,24,26,27) |
| InChIKey | ZILIGTKUXDYMPX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|