C22H23N3O4 — CID 55614624
N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2-(4-oxocinnolin-1-yl)acetamide (PubChem CID 55614624) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2-(4-oxocinnolin-1-yl)acetamide.
| Compound Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2-(4-oxocinnolin-1-yl)acetamide |
|---|---|
| PubChem CID | 55614624 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-2-(4-oxocinnolin-1-yl)acetamide |
| SMILES | CC1(C)Cc2cccc(OCCNC(=O)Cn3ncc(=O)c4ccccc43)c2O1 |
| InChI | InChI=1S/C22H23N3O4/c1-22(2)12-15-6-5-9-19(21(15)29-22)28-11-10-23-20(27)14-25-17-8-4-3-7-16(17)18(26)13-24-25/h3-9,13H,10-12,14H2,1-2H3,(H,23,27) |
| InChIKey | GGZKTJKUCNBQOG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|