C23H25N3O3 — CID 39284279
N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-4-(pyrazol-1-ylmethyl)benzamide (PubChem CID 39284279) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-4-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-4-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 39284279 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-4-(pyrazol-1-ylmethyl)benzamide |
| SMILES | CC1(C)Cc2cccc(OCCNC(=O)c3ccc(Cn4cccn4)cc3)c2O1 |
| InChI | InChI=1S/C23H25N3O3/c1-23(2)15-19-5-3-6-20(21(19)29-23)28-14-12-24-22(27)18-9-7-17(8-10-18)16-26-13-4-11-25-26/h3-11,13H,12,14-16H2,1-2H3,(H,24,27) |
| InChIKey | OIXJCFNQJRWXOH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|