C25H25FN2O5S — CID 31824874
N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-4-[(2-fluorophenyl)sulfamoyl]benzamide (PubChem CID 31824874) has the molecular formula C25H25FN2O5S and a molecular weight of 484.55 g/mol. Its IUPAC name is N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-4-[(2-fluorophenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-4-[(2-fluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 31824874 |
| Molecular Formula | C25H25FN2O5S |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-4-[(2-fluorophenyl)sulfamoyl]benzamide |
| SMILES | CC1(C)Cc2cccc(OCCNC(=O)c3ccc(S(=O)(=O)Nc4ccccc4F)cc3)c2O1 |
| InChI | InChI=1S/C25H25FN2O5S/c1-25(2)16-18-6-5-9-22(23(18)33-25)32-15-14-27-24(29)17-10-12-19(13-11-17)34(30,31)28-21-8-4-3-7-20(21)26/h3-13,28H,14-16H2,1-2H3,(H,27,29) |
| InChIKey | ZNSZIHPPOZXUQH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|