C18H21FN2O4S — CID 42572042
4-(ethylsulfamoyl)-N-[3-(2-fluorophenoxy)propyl]benzamide (PubChem CID 42572042) has the molecular formula C18H21FN2O4S and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-(ethylsulfamoyl)-N-[3-(2-fluorophenoxy)propyl]benzamide.
| Compound Name | 4-(ethylsulfamoyl)-N-[3-(2-fluorophenoxy)propyl]benzamide |
|---|---|
| PubChem CID | 42572042 |
| Molecular Formula | C18H21FN2O4S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 4-(ethylsulfamoyl)-N-[3-(2-fluorophenoxy)propyl]benzamide |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)NCCCOc2ccccc2F)cc1 |
| InChI | InChI=1S/C18H21FN2O4S/c1-2-21-26(23,24)15-10-8-14(9-11-15)18(22)20-12-5-13-25-17-7-4-3-6-16(17)19/h3-4,6-11,21H,2,5,12-13H2,1H3,(H,20,22) |
| InChIKey | DIRLRZMWWBNIEM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|