C23H26N2O3 — CID 90578657
1-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-3-(3,4-dimethylphenyl)urea (PubChem CID 90578657) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 1-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-3-(3,4-dimethylphenyl)urea.
| Compound Name | 1-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-3-(3,4-dimethylphenyl)urea |
|---|---|
| PubChem CID | 90578657 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCC#CCOc2cccc3c2OC(C)(C)C3)cc1C |
| InChI | InChI=1S/C23H26N2O3/c1-16-10-11-19(14-17(16)2)25-22(26)24-12-5-6-13-27-20-9-7-8-18-15-23(3,4)28-21(18)20/h7-11,14H,12-13,15H2,1-4H3,(H2,24,25,26) |
| InChIKey | DSMMYXLGMMZODS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|