C20H21NO3S — CID 90578620
N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-4-methylthiophene-2-carboxamide (PubChem CID 90578620) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-4-methylthiophene-2-carboxamide.
| Compound Name | N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 90578620 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-4-methylthiophene-2-carboxamide |
| SMILES | Cc1csc(C(=O)NCC#CCOc2cccc3c2OC(C)(C)C3)c1 |
| InChI | InChI=1S/C20H21NO3S/c1-14-11-17(25-13-14)19(22)21-9-4-5-10-23-16-8-6-7-15-12-20(2,3)24-18(15)16/h6-8,11,13H,9-10,12H2,1-3H3,(H,21,22) |
| InChIKey | QGOLENGHAVNLEA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|