C22H21F3N2O3 — CID 90578670
1-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 90578670) has the molecular formula C22H21F3N2O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is 1-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 90578670 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CC1(C)Cc2cccc(OCC#CCNC(=O)Nc3ccccc3C(F)(F)F)c2O1 |
| InChI | InChI=1S/C22H21F3N2O3/c1-21(2)14-15-8-7-11-18(19(15)30-21)29-13-6-5-12-26-20(28)27-17-10-4-3-9-16(17)22(23,24)25/h3-4,7-11H,12-14H2,1-2H3,(H2,26,27,28) |
| InChIKey | UNIIVJBYQZDKLV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|