C22H22ClNO3 — CID 90578530
2-(4-chlorophenyl)-N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]acetamide (PubChem CID 90578530) has the molecular formula C22H22ClNO3 and a molecular weight of 383.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]acetamide |
|---|---|
| PubChem CID | 90578530 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]acetamide |
| SMILES | CC1(C)Cc2cccc(OCC#CCNC(=O)Cc3ccc(Cl)cc3)c2O1 |
| InChI | InChI=1S/C22H22ClNO3/c1-22(2)15-17-6-5-7-19(21(17)27-22)26-13-4-3-12-24-20(25)14-16-8-10-18(23)11-9-16/h5-11H,12-15H2,1-2H3,(H,24,25) |
| InChIKey | PQRPFQZLTMSXIF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|