C19H18BrNO4 — CID 90578545
5-bromo-N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]furan-2-carboxamide (PubChem CID 90578545) has the molecular formula C19H18BrNO4 and a molecular weight of 404.26 g/mol. Its IUPAC name is 5-bromo-N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 90578545 |
| Molecular Formula | C19H18BrNO4 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 5-bromo-N-[4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]but-2-ynyl]furan-2-carboxamide |
| SMILES | CC1(C)Cc2cccc(OCC#CCNC(=O)c3ccc(Br)o3)c2O1 |
| InChI | InChI=1S/C19H18BrNO4/c1-19(2)12-13-6-5-7-14(17(13)25-19)23-11-4-3-10-21-18(22)15-8-9-16(20)24-15/h5-9H,10-12H2,1-2H3,(H,21,22) |
| InChIKey | DJVFNBZAOWSGGK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|