C23H28N2O5S — CID 55637211
N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide (PubChem CID 55637211) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide.
| Compound Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 55637211 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | N-[2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]ethyl]-3-[[(E)-2-phenylethenyl]sulfonylamino]propanamide |
| SMILES | CC1(C)Cc2cccc(OCCNC(=O)CCNS(=O)(=O)/C=C/c3ccccc3)c2O1 |
| InChI | InChI=1S/C23H28N2O5S/c1-23(2)17-19-9-6-10-20(22(19)30-23)29-15-14-24-21(26)11-13-25-31(27,28)16-12-18-7-4-3-5-8-18/h3-10,12,16,25H,11,13-15,17H2,1-2H3,(H,24,26)/b16-12+ |
| InChIKey | RHBYHKUJLXPYJJ-FOWTUZBSSA-N |
| XLogP | 2.88 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|