C26H34N2O4S — CID 55903028
N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 55903028) has the molecular formula C26H34N2O4S and a molecular weight of 470.64 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55903028 |
| Molecular Formula | C26H34N2O4S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC(C(=O)NCCOc3ccc4c(c3)CCC4)CC2)c(C)c1 |
| InChI | InChI=1S/C26H34N2O4S/c1-18-15-19(2)25(20(3)16-18)33(30,31)28-12-9-22(10-13-28)26(29)27-11-14-32-24-8-7-21-5-4-6-23(21)17-24/h7-8,15-17,22H,4-6,9-14H2,1-3H3,(H,27,29) |
| InChIKey | MJCYESKCGIOOBF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|