C25H31N3O3 — CID 55904439
3-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide (PubChem CID 55904439) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 3-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 55904439 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 3-N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-1-N-(3-methylphenyl)piperidine-1,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCCC(C(=O)NCCOc3ccc4c(c3)CCC4)C2)c1 |
| InChI | InChI=1S/C25H31N3O3/c1-18-5-2-9-22(15-18)27-25(30)28-13-4-8-21(17-28)24(29)26-12-14-31-23-11-10-19-6-3-7-20(19)16-23/h2,5,9-11,15-16,21H,3-4,6-8,12-14,17H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | MGAPMGMKZCDDEI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|