C16H25N3O2 — CID 112973614
N-[2-(2,4-dimethylphenoxy)ethyl]-4-methylpiperazine-1-carboxamide (PubChem CID 112973614) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is N-[2-(2,4-dimethylphenoxy)ethyl]-4-methylpiperazine-1-carboxamide.
| Compound Name | N-[2-(2,4-dimethylphenoxy)ethyl]-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 112973614 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N-[2-(2,4-dimethylphenoxy)ethyl]-4-methylpiperazine-1-carboxamide |
| SMILES | Cc1ccc(OCCNC(=O)N2CCN(C)CC2)c(C)c1 |
| InChI | InChI=1S/C16H25N3O2/c1-13-4-5-15(14(2)12-13)21-11-6-17-16(20)19-9-7-18(3)8-10-19/h4-5,12H,6-11H2,1-3H3,(H,17,20) |
| InChIKey | VRGDLQVABIDYFB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|