C23H30N2O2 — CID 112973670
4-benzyl-N-[2-(2,4-dimethylphenoxy)ethyl]piperidine-1-carboxamide (PubChem CID 112973670) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 4-benzyl-N-[2-(2,4-dimethylphenoxy)ethyl]piperidine-1-carboxamide.
| Compound Name | 4-benzyl-N-[2-(2,4-dimethylphenoxy)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 112973670 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 4-benzyl-N-[2-(2,4-dimethylphenoxy)ethyl]piperidine-1-carboxamide |
| SMILES | Cc1ccc(OCCNC(=O)N2CCC(Cc3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C23H30N2O2/c1-18-8-9-22(19(2)16-18)27-15-12-24-23(26)25-13-10-21(11-14-25)17-20-6-4-3-5-7-20/h3-9,16,21H,10-15,17H2,1-2H3,(H,24,26) |
| InChIKey | OTUWFUZFPVRNOC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|