C18H22F2N4O3S — CID 55407382
1-(2,5-difluorophenyl)sulfonyl-N-(3-imidazol-1-ylpropyl)piperidine-4-carboxamide (PubChem CID 55407382) has the molecular formula C18H22F2N4O3S and a molecular weight of 412.46 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)sulfonyl-N-(3-imidazol-1-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-(2,5-difluorophenyl)sulfonyl-N-(3-imidazol-1-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55407382 |
| Molecular Formula | C18H22F2N4O3S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 1-(2,5-difluorophenyl)sulfonyl-N-(3-imidazol-1-ylpropyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C18H22F2N4O3S/c19-15-2-3-16(20)17(12-15)28(26,27)24-9-4-14(5-10-24)18(25)22-6-1-8-23-11-7-21-13-23/h2-3,7,11-14H,1,4-6,8-10H2,(H,22,25) |
| InChIKey | CSJGOGCPLHZQQC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|