C18H27FN2O4S — CID 17018176
1-(5-fluoro-2-methoxyphenyl)sulfonyl-N-(3-methylbutyl)piperidine-4-carboxamide (PubChem CID 17018176) has the molecular formula C18H27FN2O4S and a molecular weight of 386.49 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxyphenyl)sulfonyl-N-(3-methylbutyl)piperidine-4-carboxamide.
| Compound Name | 1-(5-fluoro-2-methoxyphenyl)sulfonyl-N-(3-methylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17018176 |
| Molecular Formula | C18H27FN2O4S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-(5-fluoro-2-methoxyphenyl)sulfonyl-N-(3-methylbutyl)piperidine-4-carboxamide |
| SMILES | COc1ccc(F)cc1S(=O)(=O)N1CCC(C(=O)NCCC(C)C)CC1 |
| InChI | InChI=1S/C18H27FN2O4S/c1-13(2)6-9-20-18(22)14-7-10-21(11-8-14)26(23,24)17-12-15(19)4-5-16(17)25-3/h4-5,12-14H,6-11H2,1-3H3,(H,20,22) |
| InChIKey | OEYIYDAOKWSXFD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |