C14H17F2NO4S — CID 78797808
ethyl 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 78797808) has the molecular formula C14H17F2NO4S and a molecular weight of 333.36 g/mol. Its IUPAC name is ethyl 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 78797808 |
| Molecular Formula | C14H17F2NO4S |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | ethyl 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C14H17F2NO4S/c1-2-21-14(18)10-5-7-17(8-6-10)22(19,20)13-9-11(15)3-4-12(13)16/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | OVHOZCLVCHRCGD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |