C20H26F2N2O5S — CID 55460150
[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 55460150) has the molecular formula C20H26F2N2O5S and a molecular weight of 444.50 g/mol. Its IUPAC name is [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55460150 |
| Molecular Formula | C20H26F2N2O5S |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | C=C(C)CN(CC)C(=O)COC(=O)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C20H26F2N2O5S/c1-4-23(12-14(2)3)19(25)13-29-20(26)15-7-9-24(10-8-15)30(27,28)18-11-16(21)5-6-17(18)22/h5-6,11,15H,2,4,7-10,12-13H2,1,3H3 |
| InChIKey | LASAKBUSHCXSFW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|