C22H27F3N2O4 — CID 55508382
[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate (PubChem CID 55508382) has the molecular formula C22H27F3N2O4 and a molecular weight of 440.46 g/mol. Its IUPAC name is [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate.
| Compound Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55508382 |
| Molecular Formula | C22H27F3N2O4 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxylate |
| SMILES | C=C(C)CN(CC)C(=O)COC(=O)C1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H27F3N2O4/c1-4-26(13-15(2)3)19(28)14-31-21(30)17-9-11-27(12-10-17)20(29)16-5-7-18(8-6-16)22(23,24)25/h5-8,17H,2,4,9-14H2,1,3H3 |
| InChIKey | SFJDUSQGTRLFSZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|