C24H36N2O5S — CID 55311954
[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 1-(4-tert-butylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 55311954) has the molecular formula C24H36N2O5S and a molecular weight of 464.63 g/mol. Its IUPAC name is [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 1-(4-tert-butylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 1-(4-tert-butylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55311954 |
| Molecular Formula | C24H36N2O5S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 1-(4-tert-butylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | C=C(C)CN(CC)C(=O)COC(=O)C1CCN(S(=O)(=O)c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C24H36N2O5S/c1-7-25(16-18(2)3)22(27)17-31-23(28)19-12-14-26(15-13-19)32(29,30)21-10-8-20(9-11-21)24(4,5)6/h8-11,19H,2,7,12-17H2,1,3-6H3 |
| InChIKey | PIKWGRMFMWIMNC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|