C21H31NO6S — CID 46658315
(2-oxo-2-propan-2-yloxyethyl) 1-(4-tert-butylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 46658315) has the molecular formula C21H31NO6S and a molecular weight of 425.55 g/mol. Its IUPAC name is (2-oxo-2-propan-2-yloxyethyl) 1-(4-tert-butylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (2-oxo-2-propan-2-yloxyethyl) 1-(4-tert-butylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 46658315 |
| Molecular Formula | C21H31NO6S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | (2-oxo-2-propan-2-yloxyethyl) 1-(4-tert-butylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)OC(=O)COC(=O)C1CCN(S(=O)(=O)c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H31NO6S/c1-15(2)28-19(23)14-27-20(24)16-10-12-22(13-11-16)29(25,26)18-8-6-17(7-9-18)21(3,4)5/h6-9,15-16H,10-14H2,1-5H3 |
| InChIKey | KMQRPJXLFUHZNJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |