C15H19N3O6S — CID 18285375
[2-(carbamoylamino)-2-oxoethyl] 1-(benzenesulfonyl)piperidine-4-carboxylate (PubChem CID 18285375) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 1-(benzenesulfonyl)piperidine-4-carboxylate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 1-(benzenesulfonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 18285375 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 1-(benzenesulfonyl)piperidine-4-carboxylate |
| SMILES | NC(=O)NC(=O)COC(=O)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H19N3O6S/c16-15(21)17-13(19)10-24-14(20)11-6-8-18(9-7-11)25(22,23)12-4-2-1-3-5-12/h1-5,11H,6-10H2,(H3,16,17,19,21) |
| InChIKey | ZZGXRJNVOWREOQ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |