C20H21Cl2NO5S — CID 30511430
2-(2,6-dichlorophenoxy)ethyl 1-(benzenesulfonyl)piperidine-4-carboxylate (PubChem CID 30511430) has the molecular formula C20H21Cl2NO5S and a molecular weight of 458.36 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)ethyl 1-(benzenesulfonyl)piperidine-4-carboxylate.
| Compound Name | 2-(2,6-dichlorophenoxy)ethyl 1-(benzenesulfonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 30511430 |
| Molecular Formula | C20H21Cl2NO5S |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 2-(2,6-dichlorophenoxy)ethyl 1-(benzenesulfonyl)piperidine-4-carboxylate |
| SMILES | O=C(OCCOc1c(Cl)cccc1Cl)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H21Cl2NO5S/c21-17-7-4-8-18(22)19(17)27-13-14-28-20(24)15-9-11-23(12-10-15)29(25,26)16-5-2-1-3-6-16/h1-8,15H,9-14H2 |
| InChIKey | GUYKSVLJSUTYMV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|