C15H17NO4S — CID 51173015
prop-2-ynyl 1-(benzenesulfonyl)piperidine-4-carboxylate (PubChem CID 51173015) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is prop-2-ynyl 1-(benzenesulfonyl)piperidine-4-carboxylate.
| Compound Name | prop-2-ynyl 1-(benzenesulfonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 51173015 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | prop-2-ynyl 1-(benzenesulfonyl)piperidine-4-carboxylate |
| SMILES | C#CCOC(=O)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H17NO4S/c1-2-12-20-15(17)13-8-10-16(11-9-13)21(18,19)14-6-4-3-5-7-14/h1,3-7,13H,8-12H2 |
| InChIKey | MOCYGBGVBIEEQP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|