C23H29NO6S — CID 55309409
2-(3-ethylphenoxy)ethyl 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 55309409) has the molecular formula C23H29NO6S and a molecular weight of 447.55 g/mol. Its IUPAC name is 2-(3-ethylphenoxy)ethyl 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | 2-(3-ethylphenoxy)ethyl 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55309409 |
| Molecular Formula | C23H29NO6S |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 2-(3-ethylphenoxy)ethyl 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCc1cccc(OCCOC(=O)C2CCN(S(=O)(=O)c3ccc(OC)cc3)CC2)c1 |
| InChI | InChI=1S/C23H29NO6S/c1-3-18-5-4-6-21(17-18)29-15-16-30-23(25)19-11-13-24(14-12-19)31(26,27)22-9-7-20(28-2)8-10-22/h4-10,17,19H,3,11-16H2,1-2H3 |
| InChIKey | BKWNVCVTCFVOHC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|