C25H31NO7S — CID 55312272
2-(3-ethylphenoxy)ethyl 1-(4-ethoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 55312272) has the molecular formula C25H31NO7S and a molecular weight of 489.59 g/mol. Its IUPAC name is 2-(3-ethylphenoxy)ethyl 1-(4-ethoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | 2-(3-ethylphenoxy)ethyl 1-(4-ethoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55312272 |
| Molecular Formula | C25H31NO7S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 2-(3-ethylphenoxy)ethyl 1-(4-ethoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)OCCOc3cccc(CC)c3)CC2)cc1 |
| InChI | InChI=1S/C25H31NO7S/c1-3-19-6-5-7-22(18-19)32-16-17-33-25(28)21-12-14-26(15-13-21)34(29,30)23-10-8-20(9-11-23)24(27)31-4-2/h5-11,18,21H,3-4,12-17H2,1-2H3 |
| InChIKey | NARWYIPUWSJWEZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|