C23H26N2O7S — CID 55641866
(3-carbamoylphenyl)methyl 1-(4-ethoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 55641866) has the molecular formula C23H26N2O7S and a molecular weight of 474.54 g/mol. Its IUPAC name is (3-carbamoylphenyl)methyl 1-(4-ethoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (3-carbamoylphenyl)methyl 1-(4-ethoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55641866 |
| Molecular Formula | C23H26N2O7S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | (3-carbamoylphenyl)methyl 1-(4-ethoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)OCc3cccc(C(N)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C23H26N2O7S/c1-2-31-22(27)17-6-8-20(9-7-17)33(29,30)25-12-10-18(11-13-25)23(28)32-15-16-4-3-5-19(14-16)21(24)26/h3-9,14,18H,2,10-13,15H2,1H3,(H2,24,26) |
| InChIKey | ZYBNXOBLGBTDGP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 133.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |