C22H26FNO4S — CID 16541300
(3-fluorophenyl)methyl 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 16541300) has the molecular formula C22H26FNO4S and a molecular weight of 419.52 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (3-fluorophenyl)methyl 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 16541300 |
| Molecular Formula | C22H26FNO4S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (3-fluorophenyl)methyl 1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCC(C(=O)OCc3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C22H26FNO4S/c1-16(2)18-6-8-21(9-7-18)29(26,27)24-12-10-19(11-13-24)22(25)28-15-17-4-3-5-20(23)14-17/h3-9,14,16,19H,10-13,15H2,1-2H3 |
| InChIKey | ZZFGYPYBDPFQHC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |