C26H27NO5S — CID 123309908
[3-(1-methoxyethenyl)phenyl]methyl 1-naphthalen-2-ylsulfonylpiperidine-4-carboxylate (PubChem CID 123309908) has the molecular formula C26H27NO5S and a molecular weight of 465.57 g/mol. Its IUPAC name is [3-(1-methoxyethenyl)phenyl]methyl 1-naphthalen-2-ylsulfonylpiperidine-4-carboxylate.
| Compound Name | [3-(1-methoxyethenyl)phenyl]methyl 1-naphthalen-2-ylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 123309908 |
| Molecular Formula | C26H27NO5S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | [3-(1-methoxyethenyl)phenyl]methyl 1-naphthalen-2-ylsulfonylpiperidine-4-carboxylate |
| SMILES | C=C(OC)c1cccc(COC(=O)C2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)c1 |
| InChI | InChI=1S/C26H27NO5S/c1-19(31-2)23-9-5-6-20(16-23)18-32-26(28)22-12-14-27(15-13-22)33(29,30)25-11-10-21-7-3-4-8-24(21)17-25/h3-11,16-17,22H,1,12-15,18H2,2H3 |
| InChIKey | NJNZPAKRMHWNQS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|