C21H25N3O5S — CID 55634374
ethyl 4-[4-[(3-carbamoylphenyl)methyl]piperazin-1-yl]sulfonylbenzoate (PubChem CID 55634374) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is ethyl 4-[4-[(3-carbamoylphenyl)methyl]piperazin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-[(3-carbamoylphenyl)methyl]piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 55634374 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | ethyl 4-[4-[(3-carbamoylphenyl)methyl]piperazin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCN(Cc3cccc(C(N)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C21H25N3O5S/c1-2-29-21(26)17-6-8-19(9-7-17)30(27,28)24-12-10-23(11-13-24)15-16-4-3-5-18(14-16)20(22)25/h3-9,14H,2,10-13,15H2,1H3,(H2,22,25) |
| InChIKey | BKCXUTBCKDZXAE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |