C19H21ClN2O5S — CID 46602847
2-(3-chlorophenoxy)ethyl 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate (PubChem CID 46602847) has the molecular formula C19H21ClN2O5S and a molecular weight of 424.91 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)ethyl 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate.
| Compound Name | 2-(3-chlorophenoxy)ethyl 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 46602847 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 2-(3-chlorophenoxy)ethyl 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate |
| SMILES | O=C(OCCOc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C19H21ClN2O5S/c20-16-3-1-4-17(13-16)26-11-12-27-19(23)15-6-9-22(10-7-15)28(24,25)18-5-2-8-21-14-18/h1-5,8,13-15H,6-7,9-12H2 |
| InChIKey | SNVZRQRTQCYBGD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|