C23H33FN2O4 — CID 55309412
[2-[bis(2-methylpropyl)amino]-2-oxoethyl] 1-(4-fluorobenzoyl)piperidine-4-carboxylate (PubChem CID 55309412) has the molecular formula C23H33FN2O4 and a molecular weight of 420.53 g/mol. Its IUPAC name is [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 1-(4-fluorobenzoyl)piperidine-4-carboxylate.
| Compound Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 1-(4-fluorobenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 55309412 |
| Molecular Formula | C23H33FN2O4 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | [2-[bis(2-methylpropyl)amino]-2-oxoethyl] 1-(4-fluorobenzoyl)piperidine-4-carboxylate |
| SMILES | CC(C)CN(CC(C)C)C(=O)COC(=O)C1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H33FN2O4/c1-16(2)13-26(14-17(3)4)21(27)15-30-23(29)19-9-11-25(12-10-19)22(28)18-5-7-20(24)8-6-18/h5-8,16-17,19H,9-15H2,1-4H3 |
| InChIKey | KTKKZKGEPMXZJK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |