C19H26FNO3 — CID 91712006
4-methylpentyl 1-(4-fluorobenzoyl)piperidine-4-carboxylate (PubChem CID 91712006) has the molecular formula C19H26FNO3 and a molecular weight of 335.42 g/mol. Its IUPAC name is 4-methylpentyl 1-(4-fluorobenzoyl)piperidine-4-carboxylate.
| Compound Name | 4-methylpentyl 1-(4-fluorobenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 91712006 |
| Molecular Formula | C19H26FNO3 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 4-methylpentyl 1-(4-fluorobenzoyl)piperidine-4-carboxylate |
| SMILES | CC(C)CCCOC(=O)C1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H26FNO3/c1-14(2)4-3-13-24-19(23)16-9-11-21(12-10-16)18(22)15-5-7-17(20)8-6-15/h5-8,14,16H,3-4,9-13H2,1-2H3 |
| InChIKey | QEGVJHJDWCPLQV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|