C18H22FN3O5 — CID 7740040
[2-(ethylcarbamoylamino)-2-oxoethyl] 1-(4-fluorobenzoyl)piperidine-4-carboxylate (PubChem CID 7740040) has the molecular formula C18H22FN3O5 and a molecular weight of 379.39 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 1-(4-fluorobenzoyl)piperidine-4-carboxylate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 1-(4-fluorobenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7740040 |
| Molecular Formula | C18H22FN3O5 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 1-(4-fluorobenzoyl)piperidine-4-carboxylate |
| SMILES | CCNC(=O)NC(=O)COC(=O)C1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H22FN3O5/c1-2-20-18(26)21-15(23)11-27-17(25)13-7-9-22(10-8-13)16(24)12-3-5-14(19)6-4-12/h3-6,13H,2,7-11H2,1H3,(H2,20,21,23,26) |
| InChIKey | BMZILNFXCLUVKU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |