C18H17ClF2N2O4S — CID 34160582
(6-chloro-3-pyridinyl)methyl 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 34160582) has the molecular formula C18H17ClF2N2O4S and a molecular weight of 430.86 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 34160582 |
| Molecular Formula | C18H17ClF2N2O4S |
| Molecular Weight | 430.86 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | O=C(OCc1ccc(Cl)nc1)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C18H17ClF2N2O4S/c19-17-4-1-12(10-22-17)11-27-18(24)13-5-7-23(8-6-13)28(25,26)16-9-14(20)2-3-15(16)21/h1-4,9-10,13H,5-8,11H2 |
| InChIKey | FWOXTHDXLWBOJW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.86 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|