C17H22F2N2O3S — CID 9370793
cyclohexyl-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 9370793) has the molecular formula C17H22F2N2O3S and a molecular weight of 372.44 g/mol. Its IUPAC name is cyclohexyl-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | cyclohexyl-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 9370793 |
| Molecular Formula | C17H22F2N2O3S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | cyclohexyl-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C17H22F2N2O3S/c18-14-6-7-15(19)16(12-14)25(23,24)21-10-8-20(9-11-21)17(22)13-4-2-1-3-5-13/h6-7,12-13H,1-5,8-11H2 |
| InChIKey | LICCFDKVHLUPAG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |