C16H21FN2O4S — CID 110818774
cyclobutyl-[4-(5-fluoro-2-methoxyphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 110818774) has the molecular formula C16H21FN2O4S and a molecular weight of 356.42 g/mol. Its IUPAC name is cyclobutyl-[4-(5-fluoro-2-methoxyphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | cyclobutyl-[4-(5-fluoro-2-methoxyphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110818774 |
| Molecular Formula | C16H21FN2O4S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | cyclobutyl-[4-(5-fluoro-2-methoxyphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | COc1ccc(F)cc1S(=O)(=O)N1CCN(C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C16H21FN2O4S/c1-23-14-6-5-13(17)11-15(14)24(21,22)19-9-7-18(8-10-19)16(20)12-3-2-4-12/h5-6,11-12H,2-4,7-10H2,1H3 |
| InChIKey | GMRXGAOASMPXPS-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |