C15H21FN2O4S — CID 110817351
1-[4-(5-fluoro-2-methoxyphenyl)sulfonylpiperazin-1-yl]butan-1-one (PubChem CID 110817351) has the molecular formula C15H21FN2O4S and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-[4-(5-fluoro-2-methoxyphenyl)sulfonylpiperazin-1-yl]butan-1-one.
| Compound Name | 1-[4-(5-fluoro-2-methoxyphenyl)sulfonylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 110817351 |
| Molecular Formula | C15H21FN2O4S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-[4-(5-fluoro-2-methoxyphenyl)sulfonylpiperazin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCN(S(=O)(=O)c2cc(F)ccc2OC)CC1 |
| InChI | InChI=1S/C15H21FN2O4S/c1-3-4-15(19)17-7-9-18(10-8-17)23(20,21)14-11-12(16)5-6-13(14)22-2/h5-6,11H,3-4,7-10H2,1-2H3 |
| InChIKey | JCNOCTJJTDRGOX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |