C17H16F3NO4S2 — CID 71808840
1-(2,5-difluorophenyl)sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine (PubChem CID 71808840) has the molecular formula C17H16F3NO4S2 and a molecular weight of 419.45 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine.
| Compound Name | 1-(2,5-difluorophenyl)sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 71808840 |
| Molecular Formula | C17H16F3NO4S2 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 1-(2,5-difluorophenyl)sulfonyl-4-(4-fluorophenyl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C17H16F3NO4S2/c18-12-1-4-14(5-2-12)26(22,23)15-7-9-21(10-8-15)27(24,25)17-11-13(19)3-6-16(17)20/h1-6,11,15H,7-10H2 |
| InChIKey | YAHIMRAGQKLYLA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |