C14H15F2N3O4S — CID 121160518
3-[1-(2,5-difluorophenyl)sulfonylpiperidin-4-yl]imidazolidine-2,4-dione (PubChem CID 121160518) has the molecular formula C14H15F2N3O4S and a molecular weight of 359.35 g/mol. Its IUPAC name is 3-[1-(2,5-difluorophenyl)sulfonylpiperidin-4-yl]imidazolidine-2,4-dione.
| Compound Name | 3-[1-(2,5-difluorophenyl)sulfonylpiperidin-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121160518 |
| Molecular Formula | C14H15F2N3O4S |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 3-[1-(2,5-difluorophenyl)sulfonylpiperidin-4-yl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C14H15F2N3O4S/c15-9-1-2-11(16)12(7-9)24(22,23)18-5-3-10(4-6-18)19-13(20)8-17-14(19)21/h1-2,7,10H,3-6,8H2,(H,17,21) |
| InChIKey | VMVPYXKEZSIERJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|